Showing entry for 3-Hydroxy-4-Methoxybenzaldehyde Thiosemicarbazone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022726 |
| Compound Name | 3-Hydroxy-4-Methoxybenzaldehyde Thiosemicarbazone |
| Structure | ![]() |
| Formula | C9H11N3O2S |
| InchiKey | ARINKVDYBABITQ-VZUCSPMQSA-N |
| SMILES | COc1ccc(cc1O)/C=N/NC(=N)S |
| Inchi | InChI=1S/C9H11N3O2S/c1-14-8-3-2-6(4-7(8)13)5-11-12-9(10)15/h2-5,13H,1H3,(H3,10,12,15)/b11-5+ |
| IUPAC | [(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]thiourea |
| Molecular Weight | 225.06 |
| Pubchem Id | 6870649 |
| Chembl Id | CHEMBL242103 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL242103 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
