Showing entry for 9-methoxycanthin-6-one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022727 |
| Compound Name | 9-methoxycanthin-6-one |
| Structure | ![]() |
| Formula | C15H10N2O2 |
| InchiKey | OWCRARVHWCCRAG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)n1c(=O)ccc3c1c2ccn3 |
| Inchi | InChI=1S/C15H10N2O2/c1-19-9-2-3-10-11-6-7-16-12-4-5-14(18)17(15(11)12)13(10)8-9/h2-8H,1H3 |
| IUPAC | |
| Molecular Weight | 250.07 |
| Pubchem Id | 9881423 |
| Chembl Id | CHEMBL504978 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL504978 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
