Showing entry for Lucidamine A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022969 |
| Compound Name | Lucidamine A |
| Structure | ![]() |
| Formula | C23H23NO5 |
| InchiKey | OZFFCUIRRDOAHH-KRWDZBQOSA-N |
| SMILES | COc1c(OC)ccc2c1[C@H](CC(=O)C)N(C)c1c2ccc2c1cc(O)c(c2)O |
| Inchi | InChI=1S/C23H23NO5/c1-12(25)9-17-21-14(7-8-20(28-3)23(21)29-4)15-6-5-13-10-18(26)19(27)11-16(13)22(15)24(17)2/h5-8,10-11,17,26-27H,9H2,1-4H3/t17-/m0/s1 |
| IUPAC | 1-[(6S)-2,3-dihydroxy-7,8-dimethoxy-5-methyl-6H-benzo[c]phenanthridin-6-yl]propan-2-one |
| Molecular Weight | 393.16 |
| Pubchem Id | 23656474 |
| Chembl Id | CHEMBL399861 |
| Targets of Information Source | ||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||
| CHEMBL | CHEMBL399861 |
|
||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
