Showing entry for CHRYSAROBIN
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0022986 |
| Compound Name | CHRYSAROBIN |
| Structure | ![]() |
| Formula | C15H12O3 |
| InchiKey | CBEBNXQBODNTIB-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c2c(c1)cc1c(c2)c(O)c(cc1)O |
| Inchi | InChI=1S/C15H12O3/c1-8-4-10-6-9-2-3-13(16)15(18)12(9)7-11(10)14(17)5-8/h2-7,16-18H,1H3 |
| IUPAC | 6-methylanthracene-1,2,8-triol |
| Molecular Weight | 240.08 |
| Pubchem Id | 221502 |
| Chembl Id | CHEMBL1939839 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1939839 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
