Showing entry for ginkgolide A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023071 |
| Compound Name | ginkgolide A |
| Structure | ![]() |
| Formula | C20H24O9 |
| InchiKey | FPUXKXIZEIDQKW-UHFFFAOYSA-N |
| SMILES | O=C1OC2C(C1C)(O)C13C4(C2)C(OC3=O)CC(C24C(O1)OC(=O)C2O)C(C)(C)C |
| Inchi | InChI=1S/C20H24O9/c1-7-12(22)26-10-6-17-9-5-8(16(2,3)4)18(17)11(21)13(23)28-15(18)29-20(17,14(24)27-9)19(7,10)25/h7-11,15,21,25H,5-6H2,1-4H3 |
| IUPAC | |
| Molecular Weight | 408.14 |
| Pubchem Id | 115221 |
| Chembl Id | CHEMBL1408113 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1408113 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
