Showing entry for isomundulinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023469 |
| Compound Name | isomundulinol |
| Structure | ![]() |
| Formula | C25H26O5 |
| InchiKey | FTKQZUFPVWKFIA-FCHUYYIVSA-N |
| SMILES | CC(=CCc1c2OC(C)(C)C=Cc2c2c(c1O)C(=O)[C@@H]([C@H](O2)c1ccccc1)O)C |
| Inchi | InChI=1S/C25H26O5/c1-14(2)10-11-16-19(26)18-20(27)21(28)22(15-8-6-5-7-9-15)29-24(18)17-12-13-25(3,4)30-23(16)17/h5-10,12-13,21-22,26,28H,11H2,1-4H3/t21-,22+/m0/s1 |
| IUPAC | (2R,3R)-3,5-dihydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)-2-phenyl-2,3-dihydropyrano[2,3-h]chromen-4-one |
| Molecular Weight | 406.18 |
| Pubchem Id | 10476431 |
| Chembl Id | CHEMBL465972 |
| Targets of Information Source | ||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||
| CHEMBL | CHEMBL465972 |
|
||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
