Showing entry for 3',5,5',7-Tetrahydroxyflavanone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023751 |
| Compound Name | 3',5,5',7-Tetrahydroxyflavanone |
| Structure | ![]() |
| Formula | C15H12O6 |
| InchiKey | AYHOUUNTAVCXBN-ZDUSSCGKSA-N |
| SMILES | Oc1cc(O)cc(c1)[C@@H]1CC(=O)c2c(O1)cc(cc2O)O |
| Inchi | InChI=1S/C15H12O6/c16-8-1-7(2-9(17)3-8)13-6-12(20)15-11(19)4-10(18)5-14(15)21-13/h1-5,13,16-19H,6H2/t13-/m0/s1 |
| IUPAC | (2S)-2-(3,5-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| Molecular Weight | 288.06 |
| Pubchem Id | 52945930 |
| Chembl Id | CHEMBL1272251 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50114931 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1272251 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
