Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0023767 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C5H12O5 |
| InchiKey | HEBKCHPVOIAQTA-ZXFHETKHSA-N |
| SMILES | OC[C@H]([C@H]([C@H](CO)O)O)O |
| Inchi | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| IUPAC | |
| Molecular Weight | 152.07 |
| Pubchem Id | |
| Chembl Id | CHEMBL3137744 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | RB0 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3137744 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
