Showing entry for eudesmin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0024060 |
| Compound Name | eudesmin |
| Structure | ![]() |
| Formula | C22H26O6 |
| InchiKey | PEUUVVGQIVMSAW-DJDZNOHASA-N |
| SMILES | COc1cc(ccc1OC)[C@@H]1OC[C@@H]2[C@H]1CO[C@H]2c1ccc(c(c1)OC)OC |
| Inchi | InChI=1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21+,22+/m1/s1 |
| IUPAC | (3R,3aS,6R,6aS)-3,6-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| Molecular Weight | 386.17 |
| Pubchem Id | 325601 |
| Chembl Id | CHEMBL523743 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL523743 |
|
|||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
