Showing entry for 1-((3-methylbutanoyl)phloroglucinyl)-beta-D-glucopyranoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0024872 |
| Compound Name | 1-((3-methylbutanoyl)phloroglucinyl)-beta-D-glucopyranoside |
| Structure | ![]() |
| Formula | C17H24O9 |
| InchiKey | SYVLRDXITUYNAK-USACIQFYSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc(c2C(=O)CC(C)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C17H24O9/c1-7(2)3-9(20)13-10(21)4-8(19)5-11(13)25-17-16(24)15(23)14(22)12(6-18)26-17/h4-5,7,12,14-19,21-24H,3,6H2,1-2H3/t12-,14-,15+,16-,17-/m1/s1 |
| IUPAC | 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-methylbutan-1-one |
| Molecular Weight | 372.14 |
| Pubchem Id | 11485574 |
| Chembl Id | CHEMBL484029 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50260072 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL484029 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
