Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025051 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C30H46O7 |
| InchiKey | ANCYFADAQNJBNP-QYOHCCLNSA-N |
| SMILES | OC/C(=C/[C@H]1O[C@@H]2C[C@@]3([C@]([C@H]2[C@@](C1)(C)O)(C)CC(=O)[C@@]1([C@H]3[C@@H](O)C=C2[C@H]1C[C@@H]([C@@H](C2(C)C)O)O)C)C)/C |
| Inchi | InChI=1S/C30H46O7/c1-15(14-31)8-16-11-29(6,36)24-21(37-16)12-27(4)23-19(32)9-17-18(10-20(33)25(35)26(17,2)3)30(23,7)22(34)13-28(24,27)5/h8-9,16,18-21,23-25,31-33,35-36H,10-14H2,1-7H3/b15-8+/t16-,18-,19+,20+,21-,23+,24+,25+,27+,28-,29+,30-/m1/s1 |
| IUPAC | |
| Molecular Weight | 518.32 |
| Pubchem Id | 44139483 |
| Chembl Id | CHEMBL540694 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL540694 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
