Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025091 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C29H40O6 |
| InchiKey | XSRBDRDDYZWSTJ-QWIOHPELSA-N |
| SMILES | CCO[C@@H]1[C@@H]2[C@@H](C2(C)C)CC[C@@]2([C@@]1(C)C(=O)[C@@]1(O)C[C@@H]([C@@H]([C@@H]1[C@H]2O)OC(=O)c1ccccc1)C)C |
| Inchi | InChI=1S/C29H40O6/c1-7-34-23-19-18(26(19,3)4)13-14-27(5)22(30)20-21(35-24(31)17-11-9-8-10-12-17)16(2)15-29(20,33)25(32)28(23,27)6/h8-12,16,18-23,30,33H,7,13-15H2,1-6H3/t16-,18-,19-,20+,21-,22+,23+,27-,28+,29+/m0/s1 |
| IUPAC | |
| Molecular Weight | 484.28 |
| Pubchem Id | 73347364 |
| Chembl Id | CHEMBL2385643 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2385643 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
