Showing entry for Akuammicine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025317 |
| Compound Name | Akuammicine |
| Structure | ![]() |
| Formula | C20H22N2O2 |
| InchiKey | AGZMFTKKLPHOMT-DUJTVWLASA-N |
| SMILES | COC(=O)C1=C2Nc3c([C@@]42[C@@H]2C[C@H]1/C(=C\C)/CN2CC4)cccc3 |
| Inchi | InChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)17(19(23)24-2)13(12)10-16(20)22/h3-7,13,16,21H,8-11H2,1-2H3/b12-3-/t13-,16-,20+/m0/s1 |
| IUPAC | |
| Molecular Weight | 322.17 |
| Pubchem Id | 10314057 |
| Chembl Id | CHEMBL508955 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL508955 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
