Showing entry for Pyropheophorbide A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025619 |
| Compound Name | Pyropheophorbide A |
| Structure | ![]() |
| Formula | C33H34N4O3 |
| InchiKey | IEGUQQKIFBYXLG-CDIXLCFRSA-N |
| SMILES | CCC1=C(C)C2=N/C/1=C\c1[nH]c3c(c1C)C(=O)C/C/3=C\1/N=C(/C=c/3\[nH]/c(=C\2)/c(C=C)c3C)[C@H]([C@@H]1CCC(=O)O)C |
| Inchi | InChI=1S/C33H34N4O3/c1-7-19-15(3)23-12-25-17(5)21(9-10-30(39)40)32(36-25)22-11-29(38)31-18(6)26(37-33(22)31)14-28-20(8-2)16(4)24(35-28)13-27(19)34-23/h7,12-14,17,21,34,37H,1,8-11H2,2-6H3,(H,39,40)/b23-12-,24-13-,25-12-,26-14-,27-13-,28-14-,32-22-/t17-,21- |
| IUPAC | |
| Molecular Weight | 534.26 |
| Pubchem Id | |
| Chembl Id | CHEMBL520220 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL520220 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
