Showing entry for Cyclo(D-Pro-L-Val-)
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025688 |
| Compound Name | Cyclo(D-Pro-L-Val-) |
| Structure | ![]() |
| Formula | C10H16N2O2 |
| InchiKey | XLUAWXQORJEMBD-SFYZADRCSA-N |
| SMILES | CC([C@@H]1N=C(O)[C@@H]2N(C1=O)CCC2)C |
| Inchi | InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13)/t7-,8+/m1/s1 |
| IUPAC | (3S,8aR)-3-propan-2-yl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Molecular Weight | 196.12 |
| Pubchem Id | 6992260 |
| Chembl Id | CHEMBL454463 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL454463 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
