Showing entry for centratherin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0025944 |
| Compound Name | centratherin |
| Structure | ![]() |
| Formula | C20H22O7 |
| InchiKey | BMVJFNLJSZHNNS-YUDFMKBLSA-N |
| SMILES | C/C=C(\C(=O)O[C@H]1C[C@@]2(C)OC(=CC2=O)/C(=C\[C@@H]2[C@@H]1C(=C)C(=O)O2)/CO)/C |
| Inchi | InChI=1S/C20H22O7/c1-5-10(2)18(23)26-15-8-20(4)16(22)7-13(27-20)12(9-21)6-14-17(15)11(3)19(24)25-14/h5-7,14-15,17,21H,3,8-9H2,1-2,4H3/b10-5-,12-6-/t14-,15+,17+,20-/m1/s1 |
| IUPAC | |
| Molecular Weight | 374.14 |
| Pubchem Id | 44409502 |
| Chembl Id | CHEMBL382151 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL382151 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
