Showing entry for (2,5,6-triacetyloxy-9-oxo-xanthen-3-yl) Acetate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026059 |
| Compound Name | (2,5,6-triacetyloxy-9-oxo-xanthen-3-yl) Acetate |
| Structure | ![]() |
| Formula | C21H16O10 |
| InchiKey | SABQRJRRONNVJZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc2oc3c(OC(=O)C)c(ccc3c(=O)c2cc1OC(=O)C)OC(=O)C |
| Inchi | InChI=1S/C21H16O10/c1-9(22)27-15-6-5-13-19(26)14-7-17(28-10(2)23)18(29-11(3)24)8-16(14)31-20(13)21(15)30-12(4)25/h5-8H,1-4H3 |
| IUPAC | |
| Molecular Weight | 428.07 |
| Pubchem Id | 10365247 |
| Chembl Id | CHEMBL477922 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL477922 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
