Showing entry for Methyl Piperate
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026143 |
| Compound Name | Methyl Piperate |
| Structure | ![]() |
| Formula | C13H12O4 |
| InchiKey | VOZJBFJHMHRLDN-ZUVMSYQZSA-N |
| SMILES | COC(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| Inchi | InChI=1S/C13H12O4/c1-15-13(14)5-3-2-4-10-6-7-11-12(8-10)17-9-16-11/h2-8H,9H2,1H3/b4-2+,5-3+ |
| IUPAC | methyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| Molecular Weight | 232.07 |
| Pubchem Id | 9921021 |
| Chembl Id | CHEMBL42965 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50305644 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL42965 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
