Showing entry for camphorquinone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026259 |
| Compound Name | camphorquinone |
| Structure | ![]() |
| Formula | C10H14O2 |
| InchiKey | VNQXSTWCDUXYEZ-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)C2(C(C1CC2)(C)C)C |
| Inchi | InChI=1S/C10H14O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5H2,1-3H3 |
| IUPAC | 4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| Molecular Weight | 166.1 |
| Pubchem Id | 25208 |
| Chembl Id | CHEMBL301431 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL301431 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
