Showing entry for d-Ribalinidine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026360 |
| Compound Name | d-Ribalinidine |
| Structure | ![]() |
| Formula | C15H17NO4 |
| InchiKey | FQIQQNIQIRUWGC-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)c(=O)c1c(n2C)OC(C(C1)O)(C)C |
| Inchi | InChI=1S/C15H17NO4/c1-15(2)12(18)7-10-13(19)9-6-8(17)4-5-11(9)16(3)14(10)20-15/h4-6,12,17-18H,7H2,1-3H3 |
| IUPAC | 3,7-dihydroxy-2,2,10-trimethyl-3,4-dihydropyrano[2,3-b]quinolin-5-one |
| Molecular Weight | 275.12 |
| Pubchem Id | 336322 |
| Chembl Id | CHEMBL22738 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL22738 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
