Showing entry for Thamnosmonin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0026816 |
| Compound Name | Thamnosmonin |
| Structure | ![]() |
| Formula | C15H16O5 |
| InchiKey | PMZIJDMODGMWOR-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)ccc2cc1C(C(C(=C)C)O)O |
| Inchi | InChI=1S/C15H16O5/c1-8(2)14(17)15(18)10-6-9-4-5-13(16)20-11(9)7-12(10)19-3/h4-7,14-15,17-18H,1H2,2-3H3 |
| IUPAC | 6-(1,2-dihydroxy-3-methylbut-3-enyl)-7-methoxychromen-2-one |
| Molecular Weight | 276.1 |
| Pubchem Id | 312089 |
| Chembl Id | CHEMBL498094 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL498094 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
