Showing entry for Cirrhopetalanthrin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027139 |
| Compound Name | Cirrhopetalanthrin |
| Structure | ![]() |
| Formula | C30H24O6 |
| InchiKey | LCCDZCVHGDFKNQ-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(c2c1c1ccc(cc1CC2)O)c1c(O)cc(c2c1ccc1c2ccc(c1)O)OC |
| Inchi | InChI=1S/C30H24O6/c1-35-25-13-23(33)29(21-7-3-15-11-17(31)5-9-19(15)27(21)25)30-22-8-4-16-12-18(32)6-10-20(16)28(22)26(36-2)14-24(30)34/h3,5-7,9-14,31-34H,4,8H2,1-2H3 |
| IUPAC | 1-(2,7-dihydroxy-4-methoxy-9,10-dihydrophenanthren-1-yl)-4-methoxyphenanthrene-2,7-diol |
| Molecular Weight | 480.16 |
| Pubchem Id | 442695 |
| Chembl Id | CHEMBL369741 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL369741 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
