Showing entry for ISOMAMMEIGIN
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027379 |
| Compound Name | ISOMAMMEIGIN |
| Structure | ![]() |
| Formula | C25H24O5 |
| InchiKey | DJKBNLZZTMVBGL-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)c1c(O)c2C=CC(Oc2c2c1oc(=O)cc2c1ccccc1)(C)C)C |
| Inchi | InChI=1S/C25H24O5/c1-14(2)12-18(26)21-22(28)16-10-11-25(3,4)30-23(16)20-17(13-19(27)29-24(20)21)15-8-6-5-7-9-15/h5-11,13-14,28H,12H2,1-4H3 |
| IUPAC | |
| Molecular Weight | 404.16 |
| Pubchem Id | 52946774 |
| Chembl Id | CHEMBL1277682 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50330758 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1277682 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
