Showing entry for Artanomalide D
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027497 |
| Compound Name | Artanomalide D |
| Structure | ![]() |
| Formula | C32H36O8 |
| InchiKey | VFJMOBCSAQZZGH-UPBIVHIMSA-N |
| SMILES | CC(=O)O[C@@]1(C)CC[C@@H]2[C@@H]([C@@H]3C41C=C[C@]3(C1(C4)C(=O)O[C@H]3[C@H]1[C@@H](O)CC(=C1[C@@H]3C(=CC1=O)C)C)C)OC(=O)C2=C |
| Inchi | InChI=1S/C32H36O8/c1-14-12-20(35)23-25(22-15(2)11-19(34)21(14)22)39-28(37)32(23)13-31-10-9-29(32,5)26(31)24-18(16(3)27(36)38-24)7-8-30(31,6)40-17(4)33/h9-11,18,20,22-26,35H,3,7-8,12-13H2,1-2,4-6H3/t18-,20-,22-,23+,24-,25+,26-,29+,30-,31?,32?/m0/s1 |
| IUPAC | |
| Molecular Weight | 548.24 |
| Pubchem Id | 44627812 |
| Chembl Id | CHEMBL1076802 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1076802 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
