Showing entry for Atropine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027600 |
| Compound Name | Atropine |
| Structure | ![]() |
| Formula | C17H23NO3 |
| InchiKey | RKUNBYITZUJHSG-PJPHBNEVSA-N |
| SMILES | OCC(c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)N2C |
| Inchi | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15?,16? |
| IUPAC | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| Molecular Weight | 289.17 |
| Pubchem Id | 174174 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 200229 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
