Showing entry for Epihippuristanol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027736 |
| Compound Name | Epihippuristanol |
| Structure | ![]() |
| Formula | C28H46O5 |
| InchiKey | HPHXKNOXVBFETI-FELJEYOCSA-N |
| SMILES | O[C@@H]1CC[C@]2([C@H](C1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2([C@H]1C[C@H]1[C@@H]2[C@@](C)(O)[C@]2(O1)C[C@@H](C(O2)(C)C)C)C)C |
| Inchi | InChI=1S/C28H46O5/c1-15-13-28(33-24(15,2)3)27(6,31)23-21(32-28)12-19-18-8-7-16-11-17(29)9-10-25(16,4)22(18)20(30)14-26(19,23)5/h15-23,29-31H,7-14H2,1-6H3/t15-,16-,17+,18-,19-,20-,21-,22+,23-,25-,26-,27+,28-/m0/s1 |
| IUPAC | |
| Molecular Weight | 462.33 |
| Pubchem Id | 330750 |
| Chembl Id | CHEMBL458245 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL458245 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
