Showing entry for 8Beta-Hydroxy-Delta9-Tetrahydrocannabinol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0027820 |
| Compound Name | 8Beta-Hydroxy-Delta9-Tetrahydrocannabinol |
| Structure | ![]() |
| Formula | C21H30O3 |
| InchiKey | INKUWBOHCFHXTJ-BRWVUGGUSA-N |
| SMILES | CCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2C=C(C)[C@@H](C1)O)(C)C |
| Inchi | InChI=1S/C21H30O3/c1-5-6-7-8-14-10-18(23)20-15-9-13(2)17(22)12-16(15)21(3,4)24-19(20)11-14/h9-11,15-17,22-23H,5-8,12H2,1-4H3/t15-,16-,17-/m1/s1 |
| IUPAC | (6aR,8R,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol |
| Molecular Weight | 330.22 |
| Pubchem Id | 169652 |
| Chembl Id | CHEMBL3586105 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 84880 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3586105 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
