Showing entry for hainanensine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028134 |
| Compound Name | hainanensine |
| Structure | ![]() |
| Formula | C17H17NO4 |
| InchiKey | JIRBNIFNFVADKU-UHFFFAOYSA-N |
| SMILES | O=C1C2=C3CCCN3CCc3c2c(C1(C)O)c1OCOc1c3 |
| Inchi | InChI=1S/C17H17NO4/c1-17(20)14-12-9(7-11-15(14)22-8-21-11)4-6-18-5-2-3-10(18)13(12)16(17)19/h7,20H,2-6,8H2,1H3 |
| IUPAC | |
| Molecular Weight | 299.12 |
| Pubchem Id | 127616 |
| Chembl Id | CHEMBL488924 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL488924 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
