Showing entry for Tsangin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028157 |
| Compound Name | Tsangin C |
| Structure | ![]() |
| Formula | C24H30O9 |
| InchiKey | IGPMFSHAEMUEMC-LRTDBIEQSA-N |
| SMILES | COc1c(OC)cc(cc1OC)C(=O)O[C@H]([C@@H](C(=O)C)C)c1cc(OC)c(c(c1)OC)OC |
| Inchi | InChI=1S/C24H30O9/c1-13(14(2)25)21(15-9-17(27-3)22(31-7)18(10-15)28-4)33-24(26)16-11-19(29-5)23(32-8)20(12-16)30-6/h9-13,21H,1-8H3/t13-,21-/m1/s1 |
| IUPAC | [(1R,2S)-2-methyl-3-oxo-1-(3,4,5-trimethoxyphenyl)butyl] 3,4,5-trimethoxybenzoate |
| Molecular Weight | 462.19 |
| Pubchem Id | 56661913 |
| Chembl Id | CHEMBL1821992 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50353029 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1821992 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
