Showing entry for jasminodiol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028390 |
| Compound Name | jasminodiol |
| Structure | ![]() |
| Formula | C10H16O3 |
| InchiKey | JPFJQHYDGYXING-SECBINFHSA-N |
| SMILES | OCC1=CC(=O)CC([C@@H]1CO)(C)C |
| Inchi | InChI=1S/C10H16O3/c1-10(2)4-8(13)3-7(5-11)9(10)6-12/h3,9,11-12H,4-6H2,1-2H3/t9-/m1/s1 |
| IUPAC | (4S)-3,4-bis(hydroxymethyl)-5,5-dimethylcyclohex-2-en-1-one |
| Molecular Weight | 184.11 |
| Pubchem Id | 24896698 |
| Chembl Id | CHEMBL444130 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL444130 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
