Showing entry for lithospermate B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028599 |
| Compound Name | lithospermate B |
| Structure | ![]() |
| Formula | C36H30O16.Mg |
| InchiKey | ANUBYMNVOPVATP-LKYMKJHQSA-L |
| SMILES | O=C(O[C@@H](C(=O)O)Cc1ccc(c(c1)O)[O-])/C=C/c1ccc(c2c1[C@H](C(=O)O[C@@H](C(=O)O)Cc1ccc(c(c1)O)[O-])[C@H](O2)c1ccc(c(c1)O)O)O.[Mg+2] |
| Inchi | InChI=1S/C36H30O16.Mg/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17;/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48);/q;+2/p-2/b10- |
| IUPAC | magnesium;4-[(2R)-2-carboxy-2-[(E)-3-[(2S,3S)-3-[(1R)-1-carboxy-2-(3-hydroxy-4-oxidophenyl)ethoxy]carbonyl-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl]oxyethyl]-2-hydroxyphenolate |
| Molecular Weight | 716.14 |
| Pubchem Id | 6918234 |
| Chembl Id | CHEMBL39993 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL39993 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
