Showing entry for (S)-Butyrolactone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0028716 |
| Compound Name | (S)-Butyrolactone |
| Structure | ![]() |
| Formula | C4H6O2 |
| InchiKey | GSCLMSFRWBPUSK-VKHMYHEASA-N |
| SMILES | C[C@H]1CC(=O)O1 |
| Inchi | InChI=1S/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
| IUPAC | (4S)-4-methyloxetan-2-one |
| Molecular Weight | 86.04 |
| Pubchem Id | 6998969 |
| Chembl Id | CHEMBL452927 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL452927 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
