Showing entry for 8-Prenylapigenin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029123 |
| Compound Name | 8-Prenylapigenin |
| Structure | ![]() |
| Formula | C20H18O5 |
| InchiKey | MEHHCBRCXIDGKZ-UHFFFAOYSA-N |
| SMILES | CC(=CCc1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O)C |
| Inchi | InChI=1S/C20H18O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| IUPAC | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Weight | 338.12 |
| Pubchem Id | 10246505 |
| Chembl Id | CHEMBL371562 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50240972 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL371562 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
