Showing entry for Usimine A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029361 |
| Compound Name | Usimine A |
| Structure | ![]() |
| Formula | C24H25NO10 |
| InchiKey | SCYWZWOOQQSOPH-KMGGXTPGSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)O)/N=C(/C1=C(O)C=C2[C@@](C1=O)(C)c1c(O)c(C)c(c(c1O2)C(=O)C)O)\C |
| Inchi | InChI=1S/C24H25NO10/c1-9-19(29)17(11(3)26)21-18(20(9)30)24(4)14(35-21)8-13(27)16(22(24)31)10(2)25-12(23(32)33)6-7-15(28)34-5/h8,12,27,29-30H,6-7H2,1-5H3,(H,32,33)/b25-10+/t12-,24-/m0/s1 |
| IUPAC | |
| Molecular Weight | 487.15 |
| Pubchem Id | |
| Chembl Id | CHEMBL514108 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL514108 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
