Showing entry for Isoneorautenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029525 |
| Compound Name | Isoneorautenol |
| Structure | ![]() |
| Formula | C20H18O4 |
| InchiKey | WTKJOOHYNMPGLE-KXBFYZLASA-N |
| SMILES | Oc1ccc2c(c1)OC[C@@H]1[C@H]2Oc2c1cc1c(c2)OC(C=C1)(C)C |
| Inchi | InChI=1S/C20H18O4/c1-20(2)6-5-11-7-14-15-10-22-17-8-12(21)3-4-13(17)19(15)23-18(14)9-16(11)24-20/h3-9,15,19,21H,10H2,1-2H3/t15-,19-/m0/s1 |
| IUPAC | |
| Molecular Weight | 322.12 |
| Pubchem Id | 821442 |
| Chembl Id | CHEMBL1098729 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50317433 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1098729 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
