Showing entry for Ungeremine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029548 |
| Compound Name | Ungeremine |
| Structure | ![]() |
| Formula | C16H11NO3 |
| InchiKey | DFQOXFIPAAMFAU-UHFFFAOYSA-N |
| SMILES | O=c1cc2CCn3c2c(c1)c1cc2OCOc2cc1c3 |
| Inchi | InChI=1S/C16H11NO3/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17/h3-7H,1-2,8H2 |
| IUPAC | |
| Molecular Weight | 265.07 |
| Pubchem Id | 3738100 |
| Chembl Id | CHEMBL479291 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50358566 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL479291 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
