Showing entry for 1,5-Dicaffeoyl quinic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029616 |
| Compound Name | 1,5-Dicaffeoyl quinic acid |
| Structure | ![]() |
| Formula | C25H24O12 |
| InchiKey | YDDUMTOHNYZQPO-ZSGFIFMUSA-N |
| SMILES | O=C(O[C@H]1C[C@](OC(=O)/C=C/c2ccc(c(c2)O)O)(C[C@@H]([C@@H]1O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Inchi | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23-,25+/m0/s1 |
| IUPAC | (1R,3S,4S,5S)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylic acid |
| Molecular Weight | 516.13 |
| Pubchem Id | 13520496 |
| Chembl Id | CHEMBL4246398 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL4246398 |
|
|||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
