Showing entry for 6-Hydroxy-5,7-Dimethoxy-2-(4-Methoxyphenyl)Chromen-4-One
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0029863 |
| Compound Name | 6-Hydroxy-5,7-Dimethoxy-2-(4-Methoxyphenyl)Chromen-4-One |
| Structure | ![]() |
| Formula | C18H16O6 |
| InchiKey | XYHIVQHSXGOAQP-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2OC)O)OC |
| Inchi | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)17(20)18(16)23-3/h4-9,20H,1-3H3 |
| IUPAC | 6-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Molecular Weight | 328.09 |
| Pubchem Id | 243760 |
| Chembl Id | CHEMBL77695 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL77695 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
