Showing entry for Phenylpropanolamine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030001 |
| Compound Name | Phenylpropanolamine |
| Structure | ![]() |
| Formula | C9H13NO |
| InchiKey | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
| SMILES | O[C@@H](c1ccccc1)[C@H](N)C |
| Inchi | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m1/s1 |
| IUPAC | (1S,2R)-2-amino-1-phenylpropan-1-ol |
| Molecular Weight | 151.1 |
| Pubchem Id | 26934 |
| Chembl Id | CHEMBL2092846 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||
| Binding DB | 50405613 |
|
|||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2092846 |
|
|||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
