Showing entry for isofuranodiene
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030111 |
| Compound Name | isofuranodiene |
| Structure | ![]() |
| Formula | C15H20O |
| InchiKey | VMDXHYHOJPKFEK-IAVOFVOCSA-N |
| SMILES | C/C/1=C\Cc2c(C/C(=C/CC1)/C)occ2C |
| Inchi | InChI=1S/C15H20O/c1-11-5-4-6-12(2)9-15-14(8-7-11)13(3)10-16-15/h6-7,10H,4-5,8-9H2,1-3H3/b11-7+,12-6+ |
| IUPAC | (5E,9E)-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan |
| Molecular Weight | 216.15 |
| Pubchem Id | 636458 |
| Chembl Id | CHEMBL324514 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL324514 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
