Showing entry for Sparteine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030385 |
| Compound Name | Sparteine |
| Structure | ![]() |
| Formula | C15H26N2 |
| InchiKey | SLRCCWJSBJZJBV-ZQDZILKHSA-N |
| SMILES | C1CC[C@@H]2N(C1)C[C@@H]1C[C@H]2CN2[C@@H]1CCCC2 |
| Inchi | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m0/s1 |
| IUPAC | |
| Molecular Weight | 234.21 |
| Pubchem Id | 644020 |
| Chembl Id | CHEMBL1908847 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1908847 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
