Showing entry for Broussonin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030407 |
| Compound Name | Broussonin A |
| Structure | ![]() |
| Formula | C16H18O3 |
| InchiKey | MSNVBURPCQDLEP-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(c1)O)CCCc1ccc(cc1)O |
| Inchi | InChI=1S/C16H18O3/c1-19-15-10-7-13(16(18)11-15)4-2-3-12-5-8-14(17)9-6-12/h5-11,17-18H,2-4H2,1H3 |
| IUPAC | 2-[3-(4-hydroxyphenyl)propyl]-5-methoxyphenol |
| Molecular Weight | 258.13 |
| Pubchem Id | 5315502 |
| Chembl Id | CHEMBL465879 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50251012 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL465879 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
