Showing entry for 2,4-Dibromo-6-(2,4,5-tribromo-6-methoxyphenoxy)phenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030547 |
| Compound Name | 2,4-Dibromo-6-(2,4,5-tribromo-6-methoxyphenoxy)phenol |
| Structure | ![]() |
| Formula | C13H7Br5O3 |
| InchiKey | DXFJHCHPUKLLGC-UHFFFAOYSA-N |
| SMILES | COc1c(Oc2cc(Br)cc(c2O)Br)c(Br)cc(c1Br)Br |
| Inchi | InChI=1S/C13H7Br5O3/c1-20-13-10(18)6(15)4-8(17)12(13)21-9-3-5(14)2-7(16)11(9)19/h2-4,19H,1H3 |
| IUPAC | 2,4-dibromo-6-(3,4,6-tribromo-2-methoxyphenoxy)phenol |
| Molecular Weight | 605.63 |
| Pubchem Id | 21637536 |
| Chembl Id | CHEMBL374480 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL374480 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
