Showing entry for Perviridisinol C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030653 |
| Compound Name | Perviridisinol C |
| Structure | ![]() |
| Formula | C30H50O2 |
| InchiKey | UIAGZIIGWMBFBA-RODLHURISA-N |
| SMILES | OC[C@@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H]([C@H]2C)O)C)CCC(=C)C(C)C |
| Inchi | InChI=1S/C30H50O2/c1-19(2)20(3)7-8-22(17-31)24-11-13-28(6)26-10-9-23-21(4)25(32)12-14-29(23)18-30(26,29)16-15-27(24,28)5/h19,21-26,31-32H,3,7-18H2,1-2,4-6H3/t21-,22-,23-,24+,25-,26-,27+,28-,29+,30-/m0/s1 |
| IUPAC | |
| Molecular Weight | 442.38 |
| Pubchem Id | 71658236 |
| Chembl Id | CHEMBL2331817 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2331817 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
