Showing entry for 2,6-dihydroxy-3-methyl-4-methoxyacetophenone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030670 |
| Compound Name | 2,6-dihydroxy-3-methyl-4-methoxyacetophenone |
| Structure | ![]() |
| Formula | C10H12O4 |
| InchiKey | LWIPTFGZKUVFKC-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(c(c1C)O)C(=O)C |
| Inchi | InChI=1S/C10H12O4/c1-5-8(14-3)4-7(12)9(6(2)11)10(5)13/h4,12-13H,1-3H3 |
| IUPAC | 1-(2,6-dihydroxy-4-methoxy-3-methylphenyl)ethanone |
| Molecular Weight | 196.07 |
| Pubchem Id | 14602300 |
| Chembl Id | CHEMBL505640 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50294529 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL505640 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
