Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0030675 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C22H31NO5 |
| InchiKey | QAAYWVNRGVTWRB-PMVIMNEFSA-N |
| SMILES | C[C@H]1[C@H]2[C@H](O[C@@H]1[C@H]1C=C(C(=O)O1)C)CCCN1[C@H]2CC[C@H]1[C@@H]1C[C@@H](C(=O)O1)C |
| Inchi | InChI=1S/C22H31NO5/c1-11-9-17(27-21(11)24)14-6-7-15-19-13(3)20(18-10-12(2)22(25)28-18)26-16(19)5-4-8-23(14)15/h10-11,13-20H,4-9H2,1-3H3/t11-,13-,14-,15-,16+,17-,18+,19+,20-/m0/s1 |
| IUPAC | |
| Molecular Weight | 389.22 |
| Pubchem Id | 24769901 |
| Chembl Id | CHEMBL256145 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL256145 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
