Showing entry for Tylophorinine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031048 |
| Compound Name | Tylophorinine |
| Structure | ![]() |
| Formula | C23H25NO4 |
| InchiKey | LAWAARLALKUFQQ-CVDCTZTESA-N |
| SMILES | COc1ccc2c(c1)c1cc(OC)c(cc1c1c2[C@@H](O)[C@@H]2CCCN2C1)OC |
| Inchi | InChI=1S/C23H25NO4/c1-26-13-6-7-14-15(9-13)16-10-20(27-2)21(28-3)11-17(16)18-12-24-8-4-5-19(24)23(25)22(14)18/h6-7,9-11,19,23,25H,4-5,8,12H2,1-3H3/t19-,23-/m0/s1 |
| IUPAC | (13aS,14R)-3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-ol |
| Molecular Weight | 379.18 |
| Pubchem Id | 264751 |
| Chembl Id | CHEMBL398325 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 50213934 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL398325 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
