Showing entry for Butyl beta-D-glucopyranoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031057 |
| Compound Name | Butyl beta-D-glucopyranoside |
| Structure | ![]() |
| Formula | C10H20O6 |
| InchiKey | BZANQLIRVMZFOS-HOTMZDKISA-N |
| SMILES | CCCCO[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C10H20O6/c1-2-3-4-15-10-9(14)8(13)7(12)6(5-11)16-10/h6-14H,2-5H2,1H3/t6-,7-,8+,9-,10-/m1/s1 |
| IUPAC | (2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight | 236.13 |
| Pubchem Id | 111068 |
| Chembl Id | CHEMBL3326716 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3326716 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
