Showing entry for serpentine (alkaloid)
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031101 |
| Compound Name | serpentine (alkaloid) |
| Structure | ![]() |
| Formula | C21H20N2O3 |
| InchiKey | WYTGDNHDOZPMIW-VBNZEHGJSA-O |
| SMILES | COC(=O)C1=CO[C@H]([C@@H]2[C@@H]1Cc1n(C2)ccc2=c3c(=[NH+]c12)cccc3)C |
| Inchi | InChI=1S/C21H20N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-8,11-12,15-16H,9-10H2,1-2H3/p+1/t12-,15-,16+/m0/s1 |
| IUPAC | |
| Molecular Weight | 349.16 |
| Pubchem Id | 73391 |
| Chembl Id | CHEMBL3559488 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3559488 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
