Showing entry for 3-Methoxy-4-Hydroxylonchocarpin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0031128 |
| Compound Name | 3-Methoxy-4-Hydroxylonchocarpin |
| Structure | ![]() |
| Formula | C21H20O5 |
| InchiKey | WNUBZQVPFKTBOZ-QPJJXVBHSA-N |
| SMILES | COc1cc(/C=C/C(=O)c2ccc3c(c2O)C=CC(O3)(C)C)ccc1O |
| Inchi | InChI=1S/C21H20O5/c1-21(2)11-10-15-18(26-21)9-6-14(20(15)24)16(22)7-4-13-5-8-17(23)19(12-13)25-3/h4-12,23-24H,1-3H3/b7-4+ |
| IUPAC | (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| Molecular Weight | 352.13 |
| Pubchem Id | 10712965 |
| Chembl Id | CHEMBL463206 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||
| Binding DB | 50241694 |
|
|||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL463206 |
|
|||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
